C9H18ClNO4 — CID 127034620
(1S,2S,3S,6R)-6-(3-hydroxypropylamino)cyclohex-4-ene-1,2,3-triol;hydrochloride (PubChem CID 127034620) has the molecular formula C9H18ClNO4 and a molecular weight of 239.70 g/mol. Its IUPAC name is (1S,2S,3S,6R)-6-(3-hydroxypropylamino)cyclohex-4-ene-1,2,3-triol;hydrochloride.
| Compound Name | (1S,2S,3S,6R)-6-(3-hydroxypropylamino)cyclohex-4-ene-1,2,3-triol;hydrochloride |
|---|---|
| PubChem CID | 127034620 |
| Molecular Formula | C9H18ClNO4 |
| Molecular Weight | 239.70 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | (1S,2S,3S,6R)-6-(3-hydroxypropylamino)cyclohex-4-ene-1,2,3-triol;hydrochloride |
| SMILES | Cl.OCCCN[C@@H]1C=C[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C9H17NO4.ClH/c11-5-1-4-10-6-2-3-7(12)9(14)8(6)13;/h2-3,6-14H,1,4-5H2;1H/t6-,7+,8+,9+;/m1./s1 |
| InChIKey | HAHARSLOAUPIDV-BQUBBIKSSA-N |
| XLogP | -1.60 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.70 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|