C10H20ClNO3 — CID 127034622
(1S,2S,3S,6R)-6-(2-methylpropylamino)cyclohex-4-ene-1,2,3-triol;hydrochloride (PubChem CID 127034622) has the molecular formula C10H20ClNO3 and a molecular weight of 237.73 g/mol. Its IUPAC name is (1S,2S,3S,6R)-6-(2-methylpropylamino)cyclohex-4-ene-1,2,3-triol;hydrochloride.
| Compound Name | (1S,2S,3S,6R)-6-(2-methylpropylamino)cyclohex-4-ene-1,2,3-triol;hydrochloride |
|---|---|
| PubChem CID | 127034622 |
| Molecular Formula | C10H20ClNO3 |
| Molecular Weight | 237.73 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | (1S,2S,3S,6R)-6-(2-methylpropylamino)cyclohex-4-ene-1,2,3-triol;hydrochloride |
| SMILES | CC(C)CN[C@@H]1C=C[C@H](O)[C@H](O)[C@H]1O.Cl |
| InChI | InChI=1S/C10H19NO3.ClH/c1-6(2)5-11-7-3-4-8(12)10(14)9(7)13;/h3-4,6-14H,5H2,1-2H3;1H/t7-,8+,9+,10+;/m1./s1 |
| InChIKey | IZLSZCKSWMSHHR-MRUBQFBLSA-N |
| XLogP | -0.33 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.73 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|