C12H24ClNO3 — CID 127034624
(1S,2S,3S,6R)-6-(2-ethylbutylamino)cyclohex-4-ene-1,2,3-triol;hydrochloride (PubChem CID 127034624) has the molecular formula C12H24ClNO3 and a molecular weight of 265.78 g/mol. Its IUPAC name is (1S,2S,3S,6R)-6-(2-ethylbutylamino)cyclohex-4-ene-1,2,3-triol;hydrochloride.
| Compound Name | (1S,2S,3S,6R)-6-(2-ethylbutylamino)cyclohex-4-ene-1,2,3-triol;hydrochloride |
|---|---|
| PubChem CID | 127034624 |
| Molecular Formula | C12H24ClNO3 |
| Molecular Weight | 265.78 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | (1S,2S,3S,6R)-6-(2-ethylbutylamino)cyclohex-4-ene-1,2,3-triol;hydrochloride |
| SMILES | CCC(CC)CN[C@@H]1C=C[C@H](O)[C@H](O)[C@H]1O.Cl |
| InChI | InChI=1S/C12H23NO3.ClH/c1-3-8(4-2)7-13-9-5-6-10(14)12(16)11(9)15;/h5-6,8-16H,3-4,7H2,1-2H3;1H/t9-,10+,11+,12+;/m1./s1 |
| InChIKey | OPNVAYXZDYMWLM-DNFJNHEJSA-N |
| XLogP | 0.46 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.78 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|