C11H22ClNO3 — CID 127034630
(1S,2S,3S,6R)-6-(3-methylbutylamino)cyclohex-4-ene-1,2,3-triol;hydrochloride (PubChem CID 127034630) has the molecular formula C11H22ClNO3 and a molecular weight of 251.75 g/mol. Its IUPAC name is (1S,2S,3S,6R)-6-(3-methylbutylamino)cyclohex-4-ene-1,2,3-triol;hydrochloride.
| Compound Name | (1S,2S,3S,6R)-6-(3-methylbutylamino)cyclohex-4-ene-1,2,3-triol;hydrochloride |
|---|---|
| PubChem CID | 127034630 |
| Molecular Formula | C11H22ClNO3 |
| Molecular Weight | 251.75 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | (1S,2S,3S,6R)-6-(3-methylbutylamino)cyclohex-4-ene-1,2,3-triol;hydrochloride |
| SMILES | CC(C)CCN[C@@H]1C=C[C@H](O)[C@H](O)[C@H]1O.Cl |
| InChI | InChI=1S/C11H21NO3.ClH/c1-7(2)5-6-12-8-3-4-9(13)11(15)10(8)14;/h3-4,7-15H,5-6H2,1-2H3;1H/t8-,9+,10+,11+;/m1./s1 |
| InChIKey | BZZVLNBBJLONDI-NORLLQMESA-N |
| XLogP | 0.06 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.75 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|