About ethyl 7-amino-2-benzyl-1,3-dioxopyrrolo[3,4-c]pyridine-6-carboxylate
ethyl 7-amino-2-benzyl-1,3-dioxopyrrolo[3,4-c]pyridine-6-carboxylate (PubChem CID 127034658) has the molecular formula C17H15N3O4
and a molecular weight of 325.32 g/mol. Its IUPAC name is ethyl 7-amino-2-benzyl-1,3-dioxopyrrolo[3,4-c]pyridine-6-carboxylate.
Molecular Properties
| Compound Name | ethyl 7-amino-2-benzyl-1,3-dioxopyrrolo[3,4-c]pyridine-6-carboxylate |
| PubChem CID | 127034658 |
| Molecular Formula | C17H15N3O4 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | ethyl 7-amino-2-benzyl-1,3-dioxopyrrolo[3,4-c]pyridine-6-carboxylate |
| SMILES | CCOC(=O)c1ncc2c(c1N)C(=O)N(Cc1ccccc1)C2=O |
| InChI | InChI=1S/C17H15N3O4/c1-2-24-17(23)14-13(18)12-11(8-19-14)15(21)20(16(12)22)9-10-6-4-3-5-7-10/h3-8H,2,9,18H2,1H3 |
| InChIKey | WNYQIPHOTIVUJU-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 102.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze ethyl 7-amino-2-benzyl-1,3-dioxopyrrolo[3,4-c]pyridine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-amino-2-benzyl-1,3-dioxopyrrolo[3,4-c]pyridine-6-carboxylate?
The IUPAC name of ethyl 7-amino-2-benzyl-1,3-dioxopyrrolo[3,4-c]pyridine-6-carboxylate (CID 127034658) is ethyl 7-amino-2-benzyl-1,3-dioxopyrrolo[3,4-c]pyridine-6-carboxylate.
What is the SMILES notation for ethyl 7-amino-2-benzyl-1,3-dioxopyrrolo[3,4-c]pyridine-6-carboxylate?
The canonical SMILES for ethyl 7-amino-2-benzyl-1,3-dioxopyrrolo[3,4-c]pyridine-6-carboxylate is CCOC(=O)c1ncc2c(c1N)C(=O)N(Cc1ccccc1)C2=O.
What is the InChIKey of ethyl 7-amino-2-benzyl-1,3-dioxopyrrolo[3,4-c]pyridine-6-carboxylate?
The InChIKey is WNYQIPHOTIVUJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N3O4/c1-2-24-17(23)14-13(18)12-11(8-19-14)15(21)20(16(12)22)9-10-6-4-3-5-7-10/h3-8H,2,9,18H2,1H3.
What are the key properties of ethyl 7-amino-2-benzyl-1,3-dioxopyrrolo[3,4-c]pyridine-6-carboxylate?
ethyl 7-amino-2-benzyl-1,3-dioxopyrrolo[3,4-c]pyridine-6-carboxylate has a molecular weight of 325.32 g/mol, XLogP of 1.64, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-amino-2-benzyl-1,3-dioxopyrrolo[3,4-c]pyridine-6-carboxylate is sourced from PubChem (CID 127034658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).