C21H21ClN4 — CID 127034672
6-(3-amino-4-chlorophenyl)-2-methyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrimidin-4-amine (PubChem CID 127034672) has the molecular formula C21H21ClN4 and a molecular weight of 364.88 g/mol. Its IUPAC name is 6-(3-amino-4-chlorophenyl)-2-methyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrimidin-4-amine.
| Compound Name | 6-(3-amino-4-chlorophenyl)-2-methyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 127034672 |
| Molecular Formula | C21H21ClN4 |
| Molecular Weight | 364.88 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 6-(3-amino-4-chlorophenyl)-2-methyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrimidin-4-amine |
| SMILES | Cc1nc(N[C@@H]2CCCc3ccccc32)cc(-c2ccc(Cl)c(N)c2)n1 |
| InChI | InChI=1S/C21H21ClN4/c1-13-24-20(15-9-10-17(22)18(23)11-15)12-21(25-13)26-19-8-4-6-14-5-2-3-7-16(14)19/h2-3,5,7,9-12,19H,4,6,8,23H2,1H3,(H,24,25,26)/t19-/m1/s1 |
| InChIKey | ATMHIEASJFZHHI-LJQANCHMSA-N |
| XLogP | 5.18 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.88 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|