About [1-[[1-(5-phenylthieno[2,3-d]pyrimidin-4-yl)piperidin-4-yl]methyl]pyrrolidin-2-yl]methanol
[1-[[1-(5-phenylthieno[2,3-d]pyrimidin-4-yl)piperidin-4-yl]methyl]pyrrolidin-2-yl]methanol (PubChem CID 127034686) has the molecular formula C23H28N4OS
and a molecular weight of 408.57 g/mol. Its IUPAC name is [1-[[1-(5-phenylthieno[2,3-d]pyrimidin-4-yl)piperidin-4-yl]methyl]pyrrolidin-2-yl]methanol.
Molecular Properties
| Compound Name | [1-[[1-(5-phenylthieno[2,3-d]pyrimidin-4-yl)piperidin-4-yl]methyl]pyrrolidin-2-yl]methanol |
| PubChem CID | 127034686 |
| Molecular Formula | C23H28N4OS |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | [1-[[1-(5-phenylthieno[2,3-d]pyrimidin-4-yl)piperidin-4-yl]methyl]pyrrolidin-2-yl]methanol |
| SMILES | OCC1CCCN1CC1CCN(c2ncnc3scc(-c4ccccc4)c23)CC1 |
| InChI | InChI=1S/C23H28N4OS/c28-14-19-7-4-10-27(19)13-17-8-11-26(12-9-17)22-21-20(18-5-2-1-3-6-18)15-29-23(21)25-16-24-22/h1-3,5-6,15-17,19,28H,4,7-14H2 |
| InChIKey | SVYXTYIVXDKQGY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-[[1-(5-phenylthieno[2,3-d]pyrimidin-4-yl)piperidin-4-yl]methyl]pyrrolidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[[1-(5-phenylthieno[2,3-d]pyrimidin-4-yl)piperidin-4-yl]methyl]pyrrolidin-2-yl]methanol?
The IUPAC name of [1-[[1-(5-phenylthieno[2,3-d]pyrimidin-4-yl)piperidin-4-yl]methyl]pyrrolidin-2-yl]methanol (CID 127034686) is [1-[[1-(5-phenylthieno[2,3-d]pyrimidin-4-yl)piperidin-4-yl]methyl]pyrrolidin-2-yl]methanol.
What is the SMILES notation for [1-[[1-(5-phenylthieno[2,3-d]pyrimidin-4-yl)piperidin-4-yl]methyl]pyrrolidin-2-yl]methanol?
The canonical SMILES for [1-[[1-(5-phenylthieno[2,3-d]pyrimidin-4-yl)piperidin-4-yl]methyl]pyrrolidin-2-yl]methanol is OCC1CCCN1CC1CCN(c2ncnc3scc(-c4ccccc4)c23)CC1.
What is the InChIKey of [1-[[1-(5-phenylthieno[2,3-d]pyrimidin-4-yl)piperidin-4-yl]methyl]pyrrolidin-2-yl]methanol?
The InChIKey is SVYXTYIVXDKQGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28N4OS/c28-14-19-7-4-10-27(19)13-17-8-11-26(12-9-17)22-21-20(18-5-2-1-3-6-18)15-29-23(21)25-16-24-22/h1-3,5-6,15-17,19,28H,4,7-14H2.
What are the key properties of [1-[[1-(5-phenylthieno[2,3-d]pyrimidin-4-yl)piperidin-4-yl]methyl]pyrrolidin-2-yl]methanol?
[1-[[1-(5-phenylthieno[2,3-d]pyrimidin-4-yl)piperidin-4-yl]methyl]pyrrolidin-2-yl]methanol has a molecular weight of 408.57 g/mol, XLogP of 4.03, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[[1-(5-phenylthieno[2,3-d]pyrimidin-4-yl)piperidin-4-yl]methyl]pyrrolidin-2-yl]methanol is sourced from PubChem (CID 127034686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).