About 1-(6-nitro-1,3-benzoxazol-2-yl)-6-phenylhexan-1-one
1-(6-nitro-1,3-benzoxazol-2-yl)-6-phenylhexan-1-one (PubChem CID 127035005) has the molecular formula C19H18N2O4
and a molecular weight of 338.36 g/mol. Its IUPAC name is 1-(6-nitro-1,3-benzoxazol-2-yl)-6-phenylhexan-1-one.
Molecular Properties
| Compound Name | 1-(6-nitro-1,3-benzoxazol-2-yl)-6-phenylhexan-1-one |
| PubChem CID | 127035005 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 1-(6-nitro-1,3-benzoxazol-2-yl)-6-phenylhexan-1-one |
| SMILES | O=C(CCCCCc1ccccc1)c1nc2ccc([N+](=O)[O-])cc2o1 |
| InChI | InChI=1S/C19H18N2O4/c22-17(10-6-2-5-9-14-7-3-1-4-8-14)19-20-16-12-11-15(21(23)24)13-18(16)25-19/h1,3-4,7-8,11-13H,2,5-6,9-10H2 |
| InChIKey | MBCPYEGBZWHGIC-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 86.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(6-nitro-1,3-benzoxazol-2-yl)-6-phenylhexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-nitro-1,3-benzoxazol-2-yl)-6-phenylhexan-1-one?
The IUPAC name of 1-(6-nitro-1,3-benzoxazol-2-yl)-6-phenylhexan-1-one (CID 127035005) is 1-(6-nitro-1,3-benzoxazol-2-yl)-6-phenylhexan-1-one.
What is the SMILES notation for 1-(6-nitro-1,3-benzoxazol-2-yl)-6-phenylhexan-1-one?
The canonical SMILES for 1-(6-nitro-1,3-benzoxazol-2-yl)-6-phenylhexan-1-one is O=C(CCCCCc1ccccc1)c1nc2ccc([N+](=O)[O-])cc2o1.
What is the InChIKey of 1-(6-nitro-1,3-benzoxazol-2-yl)-6-phenylhexan-1-one?
The InChIKey is MBCPYEGBZWHGIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O4/c22-17(10-6-2-5-9-14-7-3-1-4-8-14)19-20-16-12-11-15(21(23)24)13-18(16)25-19/h1,3-4,7-8,11-13H,2,5-6,9-10H2.
What are the key properties of 1-(6-nitro-1,3-benzoxazol-2-yl)-6-phenylhexan-1-one?
1-(6-nitro-1,3-benzoxazol-2-yl)-6-phenylhexan-1-one has a molecular weight of 338.36 g/mol, XLogP of 4.72, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-nitro-1,3-benzoxazol-2-yl)-6-phenylhexan-1-one is sourced from PubChem (CID 127035005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).