C30H38O6S — CID 127035548
[(1R,2R,4aS,5R,8aS)-2-acetyloxy-1,4a-dimethyl-6-methylidene-5-[2-(5-oxo-2H-furan-4-yl)-2-phenylsulfanylethyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl acetate (PubChem CID 127035548) has the molecular formula C30H38O6S and a molecular weight of 526.70 g/mol. Its IUPAC name is [(1R,2R,4aS,5R,8aS)-2-acetyloxy-1,4a-dimethyl-6-methylidene-5-[2-(5-oxo-2H-furan-4-yl)-2-phenylsulfanylethyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl acetate.
| Compound Name | [(1R,2R,4aS,5R,8aS)-2-acetyloxy-1,4a-dimethyl-6-methylidene-5-[2-(5-oxo-2H-furan-4-yl)-2-phenylsulfanylethyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 127035548 |
| Molecular Formula | C30H38O6S |
| Molecular Weight | 526.70 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | [(1R,2R,4aS,5R,8aS)-2-acetyloxy-1,4a-dimethyl-6-methylidene-5-[2-(5-oxo-2H-furan-4-yl)-2-phenylsulfanylethyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl acetate |
| SMILES | C=C1CC[C@@H]2[C@](C)(COC(C)=O)[C@H](OC(C)=O)CC[C@@]2(C)[C@@H]1CC(Sc1ccccc1)C1=CCOC1=O |
| InChI | InChI=1S/C30H38O6S/c1-19-11-12-26-29(4,15-13-27(36-21(3)32)30(26,5)18-35-20(2)31)24(19)17-25(23-14-16-34-28(23)33)37-22-9-7-6-8-10-22/h6-10,14,24-27H,1,11-13,15-18H2,2-5H3/t24-,25?,26+,27-,29+,30+/m1/s1 |
| InChIKey | VXBFPGMMVNWWCC-PLUWSZGGSA-N |
| XLogP | 5.90 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.70 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|