C22H18N8O2 — CID 127035626
1-[5-(benzylamino)-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-yl]-3-phenylurea (PubChem CID 127035626) has the molecular formula C22H18N8O2 and a molecular weight of 426.44 g/mol. Its IUPAC name is 1-[5-(benzylamino)-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-yl]-3-phenylurea.
| Compound Name | 1-[5-(benzylamino)-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-yl]-3-phenylurea |
|---|---|
| PubChem CID | 127035626 |
| Molecular Formula | C22H18N8O2 |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 1-[5-(benzylamino)-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-yl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1nc(NCc2ccccc2)nc2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C22H18N8O2/c31-22(24-16-10-5-2-6-11-16)28-21-27-19(23-14-15-8-3-1-4-9-15)26-20-25-18(29-30(20)21)17-12-7-13-32-17/h1-13H,14H2,(H3,23,24,25,26,27,28,29,31) |
| InChIKey | BKGGNZPNCWNCBQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 122.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |