C17H22O11 — CID 127035660
prop-2-enyl (2S,3S,4S,5R,6S)-3,4,5,6-tetraacetyloxyoxane-2-carboxylate (PubChem CID 127035660) has the molecular formula C17H22O11 and a molecular weight of 402.35 g/mol. Its IUPAC name is prop-2-enyl (2S,3S,4S,5R,6S)-3,4,5,6-tetraacetyloxyoxane-2-carboxylate.
| Compound Name | prop-2-enyl (2S,3S,4S,5R,6S)-3,4,5,6-tetraacetyloxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 127035660 |
| Molecular Formula | C17H22O11 |
| Molecular Weight | 402.35 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | prop-2-enyl (2S,3S,4S,5R,6S)-3,4,5,6-tetraacetyloxyoxane-2-carboxylate |
| SMILES | C=CCOC(=O)[C@H]1O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C17H22O11/c1-6-7-23-16(22)14-12(24-8(2)18)13(25-9(3)19)15(26-10(4)20)17(28-14)27-11(5)21/h6,12-15,17H,1,7H2,2-5H3/t12-,13-,14-,15+,17+/m0/s1 |
| InChIKey | AGQJGYTZBDJCEL-NBFUAULTSA-N |
| XLogP | -0.20 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.35 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|