C22H23N7O2 — CID 127035805
N-[5-(cyclohexylamino)-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-yl]-2-phenylacetamide (PubChem CID 127035805) has the molecular formula C22H23N7O2 and a molecular weight of 417.47 g/mol. Its IUPAC name is N-[5-(cyclohexylamino)-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-yl]-2-phenylacetamide.
| Compound Name | N-[5-(cyclohexylamino)-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 127035805 |
| Molecular Formula | C22H23N7O2 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | N-[5-(cyclohexylamino)-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-yl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)Nc1nc(NC2CCCCC2)nc2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C22H23N7O2/c30-18(14-15-8-3-1-4-9-15)24-21-26-20(23-16-10-5-2-6-11-16)27-22-25-19(28-29(21)22)17-12-7-13-31-17/h1,3-4,7-9,12-13,16H,2,5-6,10-11,14H2,(H2,23,24,25,26,27,28,30) |
| InChIKey | FLEMRKBTYOJIRL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |