C20H27N7O — CID 127035834
5-N,7-N-dicyclohexyl-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine (PubChem CID 127035834) has the molecular formula C20H27N7O and a molecular weight of 381.48 g/mol. Its IUPAC name is 5-N,7-N-dicyclohexyl-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine.
| Compound Name | 5-N,7-N-dicyclohexyl-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine |
|---|---|
| PubChem CID | 127035834 |
| Molecular Formula | C20H27N7O |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | 5-N,7-N-dicyclohexyl-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine |
| SMILES | c1coc(-c2nc3nc(NC4CCCCC4)nc(NC4CCCCC4)n3n2)c1 |
| InChI | InChI=1S/C20H27N7O/c1-3-8-14(9-4-1)21-18-24-19(22-15-10-5-2-6-11-15)27-20(25-18)23-17(26-27)16-12-7-13-28-16/h7,12-15H,1-6,8-11H2,(H2,21,22,23,24,25,26) |
| InChIKey | VJFXMMSUQDAMEU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |