C35H51N3O5 — CID 127035843
ethyl 3-[[4-[(2S)-2-[[4-(aminomethyl)cyclohexanecarbonyl]amino]-3-(octylamino)-3-oxopropyl]phenoxy]methyl]benzoate (PubChem CID 127035843) has the molecular formula C35H51N3O5 and a molecular weight of 593.81 g/mol. Its IUPAC name is ethyl 3-[[4-[(2S)-2-[[4-(aminomethyl)cyclohexanecarbonyl]amino]-3-(octylamino)-3-oxopropyl]phenoxy]methyl]benzoate.
| Compound Name | ethyl 3-[[4-[(2S)-2-[[4-(aminomethyl)cyclohexanecarbonyl]amino]-3-(octylamino)-3-oxopropyl]phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 127035843 |
| Molecular Formula | C35H51N3O5 |
| Molecular Weight | 593.81 g/mol |
| Exact Mass | 593.38 |
| IUPAC Name | ethyl 3-[[4-[(2S)-2-[[4-(aminomethyl)cyclohexanecarbonyl]amino]-3-(octylamino)-3-oxopropyl]phenoxy]methyl]benzoate |
| SMILES | CCCCCCCCNC(=O)[C@H](Cc1ccc(OCc2cccc(C(=O)OCC)c2)cc1)NC(=O)C1CCC(CN)CC1 |
| InChI | InChI=1S/C35H51N3O5/c1-3-5-6-7-8-9-21-37-34(40)32(38-33(39)29-17-13-27(24-36)14-18-29)23-26-15-19-31(20-16-26)43-25-28-11-10-12-30(22-28)35(41)42-4-2/h10-12,15-16,19-20,22,27,29,32H,3-9,13-14,17-18,21,23-25,36H2,1-2H3,(H,37,40)(H,38,39)/t27?,29?,32-/m0/s1 |
| InChIKey | SSVHSPMGNOPDAQ-GHIDTHINSA-N |
| XLogP | 5.71 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.81 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|