About [6-(benzimidazol-1-yl)-4,5,7-trifluoro-1-benzothiophen-2-yl]-phenylmethanone
[6-(benzimidazol-1-yl)-4,5,7-trifluoro-1-benzothiophen-2-yl]-phenylmethanone (PubChem CID 127035996) has the molecular formula C22H11F3N2OS
and a molecular weight of 408.40 g/mol. Its IUPAC name is [6-(benzimidazol-1-yl)-4,5,7-trifluoro-1-benzothiophen-2-yl]-phenylmethanone.
Molecular Properties
| Compound Name | [6-(benzimidazol-1-yl)-4,5,7-trifluoro-1-benzothiophen-2-yl]-phenylmethanone |
| PubChem CID | 127035996 |
| Molecular Formula | C22H11F3N2OS |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | [6-(benzimidazol-1-yl)-4,5,7-trifluoro-1-benzothiophen-2-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1cc2c(F)c(F)c(-n3cnc4ccccc43)c(F)c2s1 |
| InChI | InChI=1S/C22H11F3N2OS/c23-17-13-10-16(21(28)12-6-2-1-3-7-12)29-22(13)19(25)20(18(17)24)27-11-26-14-8-4-5-9-15(14)27/h1-11H |
| InChIKey | BBVCTLWZEGIBDO-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze [6-(benzimidazol-1-yl)-4,5,7-trifluoro-1-benzothiophen-2-yl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(benzimidazol-1-yl)-4,5,7-trifluoro-1-benzothiophen-2-yl]-phenylmethanone?
The IUPAC name of [6-(benzimidazol-1-yl)-4,5,7-trifluoro-1-benzothiophen-2-yl]-phenylmethanone (CID 127035996) is [6-(benzimidazol-1-yl)-4,5,7-trifluoro-1-benzothiophen-2-yl]-phenylmethanone.
What is the SMILES notation for [6-(benzimidazol-1-yl)-4,5,7-trifluoro-1-benzothiophen-2-yl]-phenylmethanone?
The canonical SMILES for [6-(benzimidazol-1-yl)-4,5,7-trifluoro-1-benzothiophen-2-yl]-phenylmethanone is O=C(c1ccccc1)c1cc2c(F)c(F)c(-n3cnc4ccccc43)c(F)c2s1.
What is the InChIKey of [6-(benzimidazol-1-yl)-4,5,7-trifluoro-1-benzothiophen-2-yl]-phenylmethanone?
The InChIKey is BBVCTLWZEGIBDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H11F3N2OS/c23-17-13-10-16(21(28)12-6-2-1-3-7-12)29-22(13)19(25)20(18(17)24)27-11-26-14-8-4-5-9-15(14)27/h1-11H.
What are the key properties of [6-(benzimidazol-1-yl)-4,5,7-trifluoro-1-benzothiophen-2-yl]-phenylmethanone?
[6-(benzimidazol-1-yl)-4,5,7-trifluoro-1-benzothiophen-2-yl]-phenylmethanone has a molecular weight of 408.40 g/mol, XLogP of 5.89, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(benzimidazol-1-yl)-4,5,7-trifluoro-1-benzothiophen-2-yl]-phenylmethanone is sourced from PubChem (CID 127035996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).