About [4-[3-(4,4-dimethyl-1,4-azasilinan-1-yl)-2-methylpropyl]phenyl]-trimethylsilane
[4-[3-(4,4-dimethyl-1,4-azasilinan-1-yl)-2-methylpropyl]phenyl]-trimethylsilane (PubChem CID 127036015) has the molecular formula C19H35NSi2
and a molecular weight of 333.67 g/mol. Its IUPAC name is [4-[3-(4,4-dimethyl-1,4-azasilinan-1-yl)-2-methylpropyl]phenyl]-trimethylsilane.
Molecular Properties
| Compound Name | [4-[3-(4,4-dimethyl-1,4-azasilinan-1-yl)-2-methylpropyl]phenyl]-trimethylsilane |
| PubChem CID | 127036015 |
| Molecular Formula | C19H35NSi2 |
| Molecular Weight | 333.67 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | [4-[3-(4,4-dimethyl-1,4-azasilinan-1-yl)-2-methylpropyl]phenyl]-trimethylsilane |
| SMILES | CC(Cc1ccc([Si](C)(C)C)cc1)CN1CC[Si](C)(C)CC1 |
| InChI | InChI=1S/C19H35NSi2/c1-17(16-20-11-13-22(5,6)14-12-20)15-18-7-9-19(10-8-18)21(2,3)4/h7-10,17H,11-16H2,1-6H3 |
| InChIKey | JCQWKZLNBDZKEG-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.67 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [4-[3-(4,4-dimethyl-1,4-azasilinan-1-yl)-2-methylpropyl]phenyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[3-(4,4-dimethyl-1,4-azasilinan-1-yl)-2-methylpropyl]phenyl]-trimethylsilane?
The IUPAC name of [4-[3-(4,4-dimethyl-1,4-azasilinan-1-yl)-2-methylpropyl]phenyl]-trimethylsilane (CID 127036015) is [4-[3-(4,4-dimethyl-1,4-azasilinan-1-yl)-2-methylpropyl]phenyl]-trimethylsilane.
What is the SMILES notation for [4-[3-(4,4-dimethyl-1,4-azasilinan-1-yl)-2-methylpropyl]phenyl]-trimethylsilane?
The canonical SMILES for [4-[3-(4,4-dimethyl-1,4-azasilinan-1-yl)-2-methylpropyl]phenyl]-trimethylsilane is CC(Cc1ccc([Si](C)(C)C)cc1)CN1CC[Si](C)(C)CC1.
What is the InChIKey of [4-[3-(4,4-dimethyl-1,4-azasilinan-1-yl)-2-methylpropyl]phenyl]-trimethylsilane?
The InChIKey is JCQWKZLNBDZKEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H35NSi2/c1-17(16-20-11-13-22(5,6)14-12-20)15-18-7-9-19(10-8-18)21(2,3)4/h7-10,17H,11-16H2,1-6H3.
What are the key properties of [4-[3-(4,4-dimethyl-1,4-azasilinan-1-yl)-2-methylpropyl]phenyl]-trimethylsilane?
[4-[3-(4,4-dimethyl-1,4-azasilinan-1-yl)-2-methylpropyl]phenyl]-trimethylsilane has a molecular weight of 333.67 g/mol, XLogP of 4.43, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[3-(4,4-dimethyl-1,4-azasilinan-1-yl)-2-methylpropyl]phenyl]-trimethylsilane is sourced from PubChem (CID 127036015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).