C21H17BrO5 — CID 127036030
(2E,5E)-2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-5-[(4-hydroxy-3-methoxyphenyl)methylidene]cyclopentan-1-one (PubChem CID 127036030) has the molecular formula C21H17BrO5 and a molecular weight of 429.27 g/mol. Its IUPAC name is (2E,5E)-2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-5-[(4-hydroxy-3-methoxyphenyl)methylidene]cyclopentan-1-one.
| Compound Name | (2E,5E)-2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-5-[(4-hydroxy-3-methoxyphenyl)methylidene]cyclopentan-1-one |
|---|---|
| PubChem CID | 127036030 |
| Molecular Formula | C21H17BrO5 |
| Molecular Weight | 429.27 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | (2E,5E)-2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-5-[(4-hydroxy-3-methoxyphenyl)methylidene]cyclopentan-1-one |
| SMILES | COc1cc(/C=C2\CC/C(=C\c3cc4c(cc3Br)OCO4)C2=O)ccc1O |
| InChI | InChI=1S/C21H17BrO5/c1-25-18-7-12(2-5-17(18)23)6-13-3-4-14(21(13)24)8-15-9-19-20(10-16(15)22)27-11-26-19/h2,5-10,23H,3-4,11H2,1H3/b13-6+,14-8+ |
| InChIKey | WGSHOWULNAQTPU-HKAZRAOBSA-N |
| XLogP | 4.72 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.27 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|