C25H33N5O4 — CID 127036059
4-[2-[(1S,4aS,5R,6R,8aS)-2-[(6-aminopurin-7-yl)methyl]-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]ethyl]-2H-furan-5-one (PubChem CID 127036059) has the molecular formula C25H33N5O4 and a molecular weight of 467.57 g/mol. Its IUPAC name is 4-[2-[(1S,4aS,5R,6R,8aS)-2-[(6-aminopurin-7-yl)methyl]-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]ethyl]-2H-furan-5-one.
| Compound Name | 4-[2-[(1S,4aS,5R,6R,8aS)-2-[(6-aminopurin-7-yl)methyl]-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]ethyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 127036059 |
| Molecular Formula | C25H33N5O4 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | 4-[2-[(1S,4aS,5R,6R,8aS)-2-[(6-aminopurin-7-yl)methyl]-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]ethyl]-2H-furan-5-one |
| SMILES | C[C@]1(CO)[C@H]2CC=C(Cn3cnc4ncnc(N)c43)[C@@H](CCC3=CCOC3=O)[C@]2(C)CC[C@H]1O |
| InChI | InChI=1S/C25H33N5O4/c1-24-9-7-19(32)25(2,12-31)18(24)6-4-16(17(24)5-3-15-8-10-34-23(15)33)11-30-14-29-22-20(30)21(26)27-13-28-22/h4,8,13-14,17-19,31-32H,3,5-7,9-12H2,1-2H3,(H2,26,27,28)/t17-,18+,19-,24+,25+/m1/s1 |
| InChIKey | BSKFVAYMFIBTJD-NDPZIEMXSA-N |
| XLogP | 2.39 |
| TPSA | 136.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|