C15H14N4O3S — CID 127036155
6-hydroxy-5-[(R)-(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)-phenylmethyl]-2-sulfanylidene-1H-pyrimidin-4-one (PubChem CID 127036155) has the molecular formula C15H14N4O3S and a molecular weight of 330.37 g/mol. Its IUPAC name is 6-hydroxy-5-[(R)-(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)-phenylmethyl]-2-sulfanylidene-1H-pyrimidin-4-one.
| Compound Name | 6-hydroxy-5-[(R)-(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)-phenylmethyl]-2-sulfanylidene-1H-pyrimidin-4-one |
|---|---|
| PubChem CID | 127036155 |
| Molecular Formula | C15H14N4O3S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 6-hydroxy-5-[(R)-(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)-phenylmethyl]-2-sulfanylidene-1H-pyrimidin-4-one |
| SMILES | Cc1[nH][nH]c(=O)c1[C@@H](c1ccccc1)c1c(O)[nH]c(=S)[nH]c1=O |
| InChI | InChI=1S/C15H14N4O3S/c1-7-9(14(22)19-18-7)10(8-5-3-2-4-6-8)11-12(20)16-15(23)17-13(11)21/h2-6,10H,1H3,(H2,18,19,22)(H3,16,17,20,21,23)/t10-/m1/s1 |
| InChIKey | XIESOQOVNVGHBY-SNVBAGLBSA-N |
| XLogP | 1.64 |
| TPSA | 117.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|