C19H15F3N4O3 — CID 127036183
1-[5-(6-methoxy-3-pyridinyl)-2-(trifluoromethoxy)phenyl]-3-pyridin-4-ylurea (PubChem CID 127036183) has the molecular formula C19H15F3N4O3 and a molecular weight of 404.35 g/mol. Its IUPAC name is 1-[5-(6-methoxy-3-pyridinyl)-2-(trifluoromethoxy)phenyl]-3-pyridin-4-ylurea.
| Compound Name | 1-[5-(6-methoxy-3-pyridinyl)-2-(trifluoromethoxy)phenyl]-3-pyridin-4-ylurea |
|---|---|
| PubChem CID | 127036183 |
| Molecular Formula | C19H15F3N4O3 |
| Molecular Weight | 404.35 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 1-[5-(6-methoxy-3-pyridinyl)-2-(trifluoromethoxy)phenyl]-3-pyridin-4-ylurea |
| SMILES | COc1ccc(-c2ccc(OC(F)(F)F)c(NC(=O)Nc3ccncc3)c2)cn1 |
| InChI | InChI=1S/C19H15F3N4O3/c1-28-17-5-3-13(11-24-17)12-2-4-16(29-19(20,21)22)15(10-12)26-18(27)25-14-6-8-23-9-7-14/h2-11H,1H3,(H2,23,25,26,27) |
| InChIKey | RPXILCAORZPTRI-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.35 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |