C17H17N5O — CID 127036397
6-[4-(2,3-dimethylphenoxy)phenyl]-1,3,5-triazine-2,4-diamine (PubChem CID 127036397) has the molecular formula C17H17N5O and a molecular weight of 307.36 g/mol. Its IUPAC name is 6-[4-(2,3-dimethylphenoxy)phenyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[4-(2,3-dimethylphenoxy)phenyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 127036397 |
| Molecular Formula | C17H17N5O |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 6-[4-(2,3-dimethylphenoxy)phenyl]-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1cccc(Oc2ccc(-c3nc(N)nc(N)n3)cc2)c1C |
| InChI | InChI=1S/C17H17N5O/c1-10-4-3-5-14(11(10)2)23-13-8-6-12(7-9-13)15-20-16(18)22-17(19)21-15/h3-9H,1-2H3,(H4,18,19,20,21,22) |
| InChIKey | ZMAGMUUUUPJPKP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 99.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |