C15H12FN5O — CID 127036401
6-[4-(4-fluorophenoxy)phenyl]-1,3,5-triazine-2,4-diamine (PubChem CID 127036401) has the molecular formula C15H12FN5O and a molecular weight of 297.29 g/mol. Its IUPAC name is 6-[4-(4-fluorophenoxy)phenyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[4-(4-fluorophenoxy)phenyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 127036401 |
| Molecular Formula | C15H12FN5O |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 6-[4-(4-fluorophenoxy)phenyl]-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(-c2ccc(Oc3ccc(F)cc3)cc2)n1 |
| InChI | InChI=1S/C15H12FN5O/c16-10-3-7-12(8-4-10)22-11-5-1-9(2-6-11)13-19-14(17)21-15(18)20-13/h1-8H,(H4,17,18,19,20,21) |
| InChIKey | POXDCKHYNZNQIN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 99.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |