C20H30O3 — CID 127036417
(1S,4aS,4bR,6aR,8S,10aS,10bS,12aS)-8-hydroxy-1,10a,12a-trimethyl-1,4,4a,4b,6a,7,8,9,10,10b,11,12-dodecahydronaphtho[2,1-f]isochromen-3-one (PubChem CID 127036417) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (1S,4aS,4bR,6aR,8S,10aS,10bS,12aS)-8-hydroxy-1,10a,12a-trimethyl-1,4,4a,4b,6a,7,8,9,10,10b,11,12-dodecahydronaphtho[2,1-f]isochromen-3-one.
| Compound Name | (1S,4aS,4bR,6aR,8S,10aS,10bS,12aS)-8-hydroxy-1,10a,12a-trimethyl-1,4,4a,4b,6a,7,8,9,10,10b,11,12-dodecahydronaphtho[2,1-f]isochromen-3-one |
|---|---|
| PubChem CID | 127036417 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (1S,4aS,4bR,6aR,8S,10aS,10bS,12aS)-8-hydroxy-1,10a,12a-trimethyl-1,4,4a,4b,6a,7,8,9,10,10b,11,12-dodecahydronaphtho[2,1-f]isochromen-3-one |
| SMILES | C[C@@H]1OC(=O)C[C@H]2[C@@H]3C=C[C@H]4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C20H30O3/c1-12-19(2)9-7-16-15(17(19)11-18(22)23-12)5-4-13-10-14(21)6-8-20(13,16)3/h4-5,12-17,21H,6-11H2,1-3H3/t12-,13-,14-,15+,16-,17-,19+,20-/m0/s1 |
| InChIKey | RKMVFNWSHLKREB-ZNIJALAVSA-N |
| XLogP | 3.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|