C9H9N7O — CID 127036437
2-(furan-2-yl)-5-N-methyl-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine (PubChem CID 127036437) has the molecular formula C9H9N7O and a molecular weight of 231.22 g/mol. Its IUPAC name is 2-(furan-2-yl)-5-N-methyl-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine.
| Compound Name | 2-(furan-2-yl)-5-N-methyl-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine |
|---|---|
| PubChem CID | 127036437 |
| Molecular Formula | C9H9N7O |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 2-(furan-2-yl)-5-N-methyl-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine |
| SMILES | CNc1nc(N)n2nc(-c3ccco3)nc2n1 |
| InChI | InChI=1S/C9H9N7O/c1-11-8-13-7(10)16-9(14-8)12-6(15-16)5-3-2-4-17-5/h2-4H,1H3,(H3,10,11,12,13,14,15) |
| InChIKey | WUGXJMXVHUVBQK-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 107.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |