C19H21NO — CID 127036456
1-(4,13,14-trimethyl-3-azatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaen-5-yl)ethanone (PubChem CID 127036456) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is 1-(4,13,14-trimethyl-3-azatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaen-5-yl)ethanone.
| Compound Name | 1-(4,13,14-trimethyl-3-azatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaen-5-yl)ethanone |
|---|---|
| PubChem CID | 127036456 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 1-(4,13,14-trimethyl-3-azatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaen-5-yl)ethanone |
| SMILES | CC(=O)c1cc2c(nc1C)-c1cc(C)c(C)cc1CCC2 |
| InChI | InChI=1S/C19H21NO/c1-11-8-15-6-5-7-16-10-17(14(4)21)13(3)20-19(16)18(15)9-12(11)2/h8-10H,5-7H2,1-4H3 |
| InChIKey | ZMYITUZHJSYSBG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |