C17H15N5O2S2 — CID 127036466
4-[(12-methyl-9-thia-3,5,11-triazatricyclo[8.4.0.02,7]tetradeca-1(10),2,4,6,11,13-hexaen-4-yl)amino]benzenesulfonamide (PubChem CID 127036466) has the molecular formula C17H15N5O2S2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 4-[(12-methyl-9-thia-3,5,11-triazatricyclo[8.4.0.02,7]tetradeca-1(10),2,4,6,11,13-hexaen-4-yl)amino]benzenesulfonamide.
| Compound Name | 4-[(12-methyl-9-thia-3,5,11-triazatricyclo[8.4.0.02,7]tetradeca-1(10),2,4,6,11,13-hexaen-4-yl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 127036466 |
| Molecular Formula | C17H15N5O2S2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 4-[(12-methyl-9-thia-3,5,11-triazatricyclo[8.4.0.02,7]tetradeca-1(10),2,4,6,11,13-hexaen-4-yl)amino]benzenesulfonamide |
| SMILES | Cc1ccc2c(n1)SCc1cnc(Nc3ccc(S(N)(=O)=O)cc3)nc1-2 |
| InChI | InChI=1S/C17H15N5O2S2/c1-10-2-7-14-15-11(9-25-16(14)20-10)8-19-17(22-15)21-12-3-5-13(6-4-12)26(18,23)24/h2-8H,9H2,1H3,(H2,18,23,24)(H,19,21,22) |
| InChIKey | ZOEYPWOMIXAXOI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |