C17H15Cl2F2NO3S — CID 127036571
[(2S,5R)-1-(3,5-dichloro-4-fluorophenyl)sulfonyl-5-(4-fluorophenyl)pyrrolidin-2-yl]methanol (PubChem CID 127036571) has the molecular formula C17H15Cl2F2NO3S and a molecular weight of 422.28 g/mol. Its IUPAC name is [(2S,5R)-1-(3,5-dichloro-4-fluorophenyl)sulfonyl-5-(4-fluorophenyl)pyrrolidin-2-yl]methanol.
| Compound Name | [(2S,5R)-1-(3,5-dichloro-4-fluorophenyl)sulfonyl-5-(4-fluorophenyl)pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 127036571 |
| Molecular Formula | C17H15Cl2F2NO3S |
| Molecular Weight | 422.28 g/mol |
| Exact Mass | 421.01 |
| IUPAC Name | [(2S,5R)-1-(3,5-dichloro-4-fluorophenyl)sulfonyl-5-(4-fluorophenyl)pyrrolidin-2-yl]methanol |
| SMILES | O=S(=O)(c1cc(Cl)c(F)c(Cl)c1)N1[C@H](CO)CC[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C17H15Cl2F2NO3S/c18-14-7-13(8-15(19)17(14)21)26(24,25)22-12(9-23)5-6-16(22)10-1-3-11(20)4-2-10/h1-4,7-8,12,16,23H,5-6,9H2/t12-,16+/m0/s1 |
| InChIKey | YBPKDCWIZDLZLH-BLLLJJGKSA-N |
| XLogP | 4.16 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.28 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|