C13H18ClNO3 — CID 127036664
(1S,2S,3S,6R)-6-(benzylamino)cyclohex-4-ene-1,2,3-triol;hydrochloride (PubChem CID 127036664) has the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. Its IUPAC name is (1S,2S,3S,6R)-6-(benzylamino)cyclohex-4-ene-1,2,3-triol;hydrochloride.
| Compound Name | (1S,2S,3S,6R)-6-(benzylamino)cyclohex-4-ene-1,2,3-triol;hydrochloride |
|---|---|
| PubChem CID | 127036664 |
| Molecular Formula | C13H18ClNO3 |
| Molecular Weight | 271.74 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | (1S,2S,3S,6R)-6-(benzylamino)cyclohex-4-ene-1,2,3-triol;hydrochloride |
| SMILES | Cl.O[C@@H]1[C@@H](O)[C@H](NCc2ccccc2)C=C[C@@H]1O |
| InChI | InChI=1S/C13H17NO3.ClH/c15-11-7-6-10(12(16)13(11)17)14-8-9-4-2-1-3-5-9;/h1-7,10-17H,8H2;1H/t10-,11+,12+,13+;/m1./s1 |
| InChIKey | SXANRKMVFPNIKO-VHICAWHZSA-N |
| XLogP | 0.22 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.74 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|