C20H12Cl2N2O3 — CID 127036806
1,2-bis(4-chlorophenyl)-4-(furan-2-ylmethylidene)pyrazolidine-3,5-dione (PubChem CID 127036806) has the molecular formula C20H12Cl2N2O3 and a molecular weight of 399.23 g/mol. Its IUPAC name is 1,2-bis(4-chlorophenyl)-4-(furan-2-ylmethylidene)pyrazolidine-3,5-dione.
| Compound Name | 1,2-bis(4-chlorophenyl)-4-(furan-2-ylmethylidene)pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 127036806 |
| Molecular Formula | C20H12Cl2N2O3 |
| Molecular Weight | 399.23 g/mol |
| Exact Mass | 398.02 |
| IUPAC Name | 1,2-bis(4-chlorophenyl)-4-(furan-2-ylmethylidene)pyrazolidine-3,5-dione |
| SMILES | O=C1C(=Cc2ccco2)C(=O)N(c2ccc(Cl)cc2)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H12Cl2N2O3/c21-13-3-7-15(8-4-13)23-19(25)18(12-17-2-1-11-27-17)20(26)24(23)16-9-5-14(22)6-10-16/h1-12H |
| InChIKey | IGCLNRBZTKYYAT-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.23 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|