C16H14FN7O — CID 127036845
7-N-[(4-fluorophenyl)methyl]-2-(furan-2-yl)-5-N-methyl-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine (PubChem CID 127036845) has the molecular formula C16H14FN7O and a molecular weight of 339.33 g/mol. Its IUPAC name is 7-N-[(4-fluorophenyl)methyl]-2-(furan-2-yl)-5-N-methyl-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine.
| Compound Name | 7-N-[(4-fluorophenyl)methyl]-2-(furan-2-yl)-5-N-methyl-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine |
|---|---|
| PubChem CID | 127036845 |
| Molecular Formula | C16H14FN7O |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 7-N-[(4-fluorophenyl)methyl]-2-(furan-2-yl)-5-N-methyl-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine |
| SMILES | CNc1nc(NCc2ccc(F)cc2)n2nc(-c3ccco3)nc2n1 |
| InChI | InChI=1S/C16H14FN7O/c1-18-14-21-15(19-9-10-4-6-11(17)7-5-10)24-16(22-14)20-13(23-24)12-3-2-8-25-12/h2-8H,9H2,1H3,(H2,18,19,20,21,22,23) |
| InChIKey | MXCUPECTZIYFES-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |