C36H49N3O3 — CID 127036847
4-(aminomethyl)-N-[(2S)-3-[4-(naphthalen-2-ylmethoxy)phenyl]-1-(octylamino)-1-oxopropan-2-yl]cyclohexane-1-carboxamide (PubChem CID 127036847) has the molecular formula C36H49N3O3 and a molecular weight of 571.81 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[(2S)-3-[4-(naphthalen-2-ylmethoxy)phenyl]-1-(octylamino)-1-oxopropan-2-yl]cyclohexane-1-carboxamide.
| Compound Name | 4-(aminomethyl)-N-[(2S)-3-[4-(naphthalen-2-ylmethoxy)phenyl]-1-(octylamino)-1-oxopropan-2-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 127036847 |
| Molecular Formula | C36H49N3O3 |
| Molecular Weight | 571.81 g/mol |
| Exact Mass | 571.38 |
| IUPAC Name | 4-(aminomethyl)-N-[(2S)-3-[4-(naphthalen-2-ylmethoxy)phenyl]-1-(octylamino)-1-oxopropan-2-yl]cyclohexane-1-carboxamide |
| SMILES | CCCCCCCCNC(=O)[C@H](Cc1ccc(OCc2ccc3ccccc3c2)cc1)NC(=O)C1CCC(CN)CC1 |
| InChI | InChI=1S/C36H49N3O3/c1-2-3-4-5-6-9-22-38-36(41)34(39-35(40)31-18-12-28(25-37)13-19-31)24-27-15-20-33(21-16-27)42-26-29-14-17-30-10-7-8-11-32(30)23-29/h7-8,10-11,14-17,20-21,23,28,31,34H,2-6,9,12-13,18-19,22,24-26,37H2,1H3,(H,38,41)(H,39,40)/t28?,31?,34-/m0/s1 |
| InChIKey | GXWARQIPVDSJKJ-ZFAORPCOSA-N |
| XLogP | 6.69 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.81 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|