C12H12O3 — CID 127036939
(1aR,7R,7aR,7bR)-7,7a-dimethyl-7,7b-dihydro-1aH-naphtho[1,2-b]oxirene-2,6-dione (PubChem CID 127036939) has the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. Its IUPAC name is (1aR,7R,7aR,7bR)-7,7a-dimethyl-7,7b-dihydro-1aH-naphtho[1,2-b]oxirene-2,6-dione.
| Compound Name | (1aR,7R,7aR,7bR)-7,7a-dimethyl-7,7b-dihydro-1aH-naphtho[1,2-b]oxirene-2,6-dione |
|---|---|
| PubChem CID | 127036939 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | (1aR,7R,7aR,7bR)-7,7a-dimethyl-7,7b-dihydro-1aH-naphtho[1,2-b]oxirene-2,6-dione |
| SMILES | C[C@H]1C(=O)C=CC2=CC(=O)[C@@H]3O[C@@H]3[C@@]21C |
| InChI | InChI=1S/C12H12O3/c1-6-8(13)4-3-7-5-9(14)10-11(15-10)12(6,7)2/h3-6,10-11H,1-2H3/t6-,10-,11-,12+/m0/s1 |
| InChIKey | GQPDPQGHFJRPGT-DDQZHCRQSA-N |
| XLogP | 1.04 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|