C17H25NO11 — CID 127036956
[(2S,3R,4S,5S,6S)-2,3,5-triacetyloxy-6-(3-hydroxypropylcarbamoyl)oxan-4-yl] acetate (PubChem CID 127036956) has the molecular formula C17H25NO11 and a molecular weight of 419.38 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6S)-2,3,5-triacetyloxy-6-(3-hydroxypropylcarbamoyl)oxan-4-yl] acetate.
| Compound Name | [(2S,3R,4S,5S,6S)-2,3,5-triacetyloxy-6-(3-hydroxypropylcarbamoyl)oxan-4-yl] acetate |
|---|---|
| PubChem CID | 127036956 |
| Molecular Formula | C17H25NO11 |
| Molecular Weight | 419.38 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | [(2S,3R,4S,5S,6S)-2,3,5-triacetyloxy-6-(3-hydroxypropylcarbamoyl)oxan-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1O[C@H](C(=O)NCCCO)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C17H25NO11/c1-8(20)25-12-13(26-9(2)21)15(27-10(3)22)17(28-11(4)23)29-14(12)16(24)18-6-5-7-19/h12-15,17,19H,5-7H2,1-4H3,(H,18,24)/t12-,13-,14-,15+,17+/m0/s1 |
| InChIKey | XURJPSAZVHLJDB-NBFUAULTSA-N |
| XLogP | -1.43 |
| TPSA | 163.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.38 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|