C15H21NO7 — CID 127037008
(2S,3S,4S,5R)-3,4,5-trihydroxy-5-(hydroxymethyl)-N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]oxolane-2-carboxamide (PubChem CID 127037008) has the molecular formula C15H21NO7 and a molecular weight of 327.33 g/mol. Its IUPAC name is (2S,3S,4S,5R)-3,4,5-trihydroxy-5-(hydroxymethyl)-N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]oxolane-2-carboxamide.
| Compound Name | (2S,3S,4S,5R)-3,4,5-trihydroxy-5-(hydroxymethyl)-N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 127037008 |
| Molecular Formula | C15H21NO7 |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | (2S,3S,4S,5R)-3,4,5-trihydroxy-5-(hydroxymethyl)-N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]oxolane-2-carboxamide |
| SMILES | O=C(N[C@H](CO)Cc1ccccc1)[C@H]1O[C@](O)(CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H21NO7/c17-7-10(6-9-4-2-1-3-5-9)16-14(21)12-11(19)13(20)15(22,8-18)23-12/h1-5,10-13,17-20,22H,6-8H2,(H,16,21)/t10-,11+,12-,13-,15+/m0/s1 |
| InChIKey | BMCXUXCMHFJNHK-WHRXGGIHSA-N |
| XLogP | -2.49 |
| TPSA | 139.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |