C41H37N3O5 — CID 127037250
5-[[4-[2-phenylmethoxyethyl(2-trityloxyethyl)amino]phenyl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 127037250) has the molecular formula C41H37N3O5 and a molecular weight of 651.76 g/mol. Its IUPAC name is 5-[[4-[2-phenylmethoxyethyl(2-trityloxyethyl)amino]phenyl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[4-[2-phenylmethoxyethyl(2-trityloxyethyl)amino]phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 127037250 |
| Molecular Formula | C41H37N3O5 |
| Molecular Weight | 651.76 g/mol |
| Exact Mass | 651.27 |
| IUPAC Name | 5-[[4-[2-phenylmethoxyethyl(2-trityloxyethyl)amino]phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(=Cc2ccc(N(CCOCc3ccccc3)CCOC(c3ccccc3)(c3ccccc3)c3ccccc3)cc2)C(=O)N1 |
| InChI | InChI=1S/C41H37N3O5/c45-38-37(39(46)43-40(47)42-38)29-31-21-23-36(24-22-31)44(25-27-48-30-32-13-5-1-6-14-32)26-28-49-41(33-15-7-2-8-16-33,34-17-9-3-10-18-34)35-19-11-4-12-20-35/h1-24,29H,25-28,30H2,(H2,42,43,45,46,47) |
| InChIKey | SEXZWIRWQHDHFL-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.76 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|