C19H15N7S3 — CID 127037320
4-(1,3-benzothiazol-2-yl)-3-N-[4-(1,3-thiazol-2-ylamino)sulfanylphenyl]-1H-pyrazole-3,5-diamine (PubChem CID 127037320) has the molecular formula C19H15N7S3 and a molecular weight of 437.58 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-3-N-[4-(1,3-thiazol-2-ylamino)sulfanylphenyl]-1H-pyrazole-3,5-diamine.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-3-N-[4-(1,3-thiazol-2-ylamino)sulfanylphenyl]-1H-pyrazole-3,5-diamine |
|---|---|
| PubChem CID | 127037320 |
| Molecular Formula | C19H15N7S3 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-3-N-[4-(1,3-thiazol-2-ylamino)sulfanylphenyl]-1H-pyrazole-3,5-diamine |
| SMILES | Nc1[nH]nc(Nc2ccc(SNc3nccs3)cc2)c1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C19H15N7S3/c20-16-15(18-23-13-3-1-2-4-14(13)28-18)17(25-24-16)22-11-5-7-12(8-6-11)29-26-19-21-9-10-27-19/h1-10H,(H,21,26)(H4,20,22,24,25) |
| InChIKey | UKAMIEAFDOKWOO-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|