C27H34N4O2S — CID 127037326
(1R,2R,3R,4S)-3-N-(3-methyl-1,2-benzothiazol-6-yl)-2-N-(4-pyrrolidin-1-ylbutyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide (PubChem CID 127037326) has the molecular formula C27H34N4O2S and a molecular weight of 478.66 g/mol. Its IUPAC name is (1R,2R,3R,4S)-3-N-(3-methyl-1,2-benzothiazol-6-yl)-2-N-(4-pyrrolidin-1-ylbutyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide.
| Compound Name | (1R,2R,3R,4S)-3-N-(3-methyl-1,2-benzothiazol-6-yl)-2-N-(4-pyrrolidin-1-ylbutyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide |
|---|---|
| PubChem CID | 127037326 |
| Molecular Formula | C27H34N4O2S |
| Molecular Weight | 478.66 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | (1R,2R,3R,4S)-3-N-(3-methyl-1,2-benzothiazol-6-yl)-2-N-(4-pyrrolidin-1-ylbutyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide |
| SMILES | Cc1nsc2cc(NC(=O)[C@H]3[C@H](C(=O)NCCCCN4CCCC4)[C@H]4C=C[C@@H]3C43CC3)ccc12 |
| InChI | InChI=1S/C27H34N4O2S/c1-17-19-7-6-18(16-22(19)34-30-17)29-26(33)24-21-9-8-20(27(21)10-11-27)23(24)25(32)28-12-2-3-13-31-14-4-5-15-31/h6-9,16,20-21,23-24H,2-5,10-15H2,1H3,(H,28,32)(H,29,33)/t20-,21+,23-,24-/m1/s1 |
| InChIKey | OGBMXKUJMIHJEQ-CBJLPSGESA-N |
| XLogP | 4.36 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.66 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|