About 1-[3-[3-(3-aminopropylamino)propylamino]propyl]-5-methylpyrimidine-2,4-dione;trihydrochloride
1-[3-[3-(3-aminopropylamino)propylamino]propyl]-5-methylpyrimidine-2,4-dione;trihydrochloride (PubChem CID 127037343) has the molecular formula C14H30Cl3N5O2
and a molecular weight of 406.79 g/mol. Its IUPAC name is 1-[3-[3-(3-aminopropylamino)propylamino]propyl]-5-methylpyrimidine-2,4-dione;trihydrochloride.
Molecular Properties
| Compound Name | 1-[3-[3-(3-aminopropylamino)propylamino]propyl]-5-methylpyrimidine-2,4-dione;trihydrochloride |
| PubChem CID | 127037343 |
| Molecular Formula | C14H30Cl3N5O2 |
| Molecular Weight | 406.79 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 1-[3-[3-(3-aminopropylamino)propylamino]propyl]-5-methylpyrimidine-2,4-dione;trihydrochloride |
| SMILES | Cc1cn(CCCNCCCNCCCN)c(=O)[nH]c1=O.Cl.Cl.Cl |
| InChI | InChI=1S/C14H27N5O2.3ClH/c1-12-11-19(14(21)18-13(12)20)10-4-9-17-8-3-7-16-6-2-5-15;;;/h11,16-17H,2-10,15H2,1H3,(H,18,20,21);3*1H |
| InChIKey | FZHAFWXVWOPAHN-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.79 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-[3-(3-aminopropylamino)propylamino]propyl]-5-methylpyrimidine-2,4-dione;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[3-(3-aminopropylamino)propylamino]propyl]-5-methylpyrimidine-2,4-dione;trihydrochloride?
The IUPAC name of 1-[3-[3-(3-aminopropylamino)propylamino]propyl]-5-methylpyrimidine-2,4-dione;trihydrochloride (CID 127037343) is 1-[3-[3-(3-aminopropylamino)propylamino]propyl]-5-methylpyrimidine-2,4-dione;trihydrochloride.
What is the SMILES notation for 1-[3-[3-(3-aminopropylamino)propylamino]propyl]-5-methylpyrimidine-2,4-dione;trihydrochloride?
The canonical SMILES for 1-[3-[3-(3-aminopropylamino)propylamino]propyl]-5-methylpyrimidine-2,4-dione;trihydrochloride is Cc1cn(CCCNCCCNCCCN)c(=O)[nH]c1=O.Cl.Cl.Cl.
What is the InChIKey of 1-[3-[3-(3-aminopropylamino)propylamino]propyl]-5-methylpyrimidine-2,4-dione;trihydrochloride?
The InChIKey is FZHAFWXVWOPAHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27N5O2.3ClH/c1-12-11-19(14(21)18-13(12)20)10-4-9-17-8-3-7-16-6-2-5-15;;;/h11,16-17H,2-10,15H2,1H3,(H,18,20,21);3*1H.
What are the key properties of 1-[3-[3-(3-aminopropylamino)propylamino]propyl]-5-methylpyrimidine-2,4-dione;trihydrochloride?
1-[3-[3-(3-aminopropylamino)propylamino]propyl]-5-methylpyrimidine-2,4-dione;trihydrochloride has a molecular weight of 406.79 g/mol, XLogP of 0.42, 11 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[3-(3-aminopropylamino)propylamino]propyl]-5-methylpyrimidine-2,4-dione;trihydrochloride is sourced from PubChem (CID 127037343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).