C18H15ClKNO2 — CID 127037388
potassium (2S)-2-[[(E)-3-(4-chlorophenyl)prop-2-enylidene]amino]-3-phenylpropanoate (PubChem CID 127037388) has the molecular formula C18H15ClKNO2 and a molecular weight of 351.87 g/mol. Its IUPAC name is potassium (2S)-2-[[(E)-3-(4-chlorophenyl)prop-2-enylidene]amino]-3-phenylpropanoate.
| Compound Name | potassium (2S)-2-[[(E)-3-(4-chlorophenyl)prop-2-enylidene]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 127037388 |
| Molecular Formula | C18H15ClKNO2 |
| Molecular Weight | 351.87 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | potassium (2S)-2-[[(E)-3-(4-chlorophenyl)prop-2-enylidene]amino]-3-phenylpropanoate |
| SMILES | O=C([O-])[C@H](Cc1ccccc1)/N=C/C=C/c1ccc(Cl)cc1.[K+] |
| InChI | InChI=1S/C18H16ClNO2.K/c19-16-10-8-14(9-11-16)7-4-12-20-17(18(21)22)13-15-5-2-1-3-6-15;/h1-12,17H,13H2,(H,21,22);/q;+1/p-1/b7-4+,20-12+;/t17-;/m0./s1 |
| InChIKey | PDKWYWUEKLAUQC-CGIVAXKFSA-M |
| XLogP | -0.21 |
| TPSA | 52.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.87 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|