C32H51NO3 — CID 127037419
(1S,2R,4aS,6aR,6aS,6bR,8aR,12aR,14bS)-N-methoxy-N,1,2,6a,6b,9,9,12a-octamethyl-10-oxo-1,2,3,4,5,6,6a,7,8,8a,11,12,13,14b-tetradecahydropicene-4a-carboxamide (PubChem CID 127037419) has the molecular formula C32H51NO3 and a molecular weight of 497.76 g/mol. Its IUPAC name is (1S,2R,4aS,6aR,6aS,6bR,8aR,12aR,14bS)-N-methoxy-N,1,2,6a,6b,9,9,12a-octamethyl-10-oxo-1,2,3,4,5,6,6a,7,8,8a,11,12,13,14b-tetradecahydropicene-4a-carboxamide.
| Compound Name | (1S,2R,4aS,6aR,6aS,6bR,8aR,12aR,14bS)-N-methoxy-N,1,2,6a,6b,9,9,12a-octamethyl-10-oxo-1,2,3,4,5,6,6a,7,8,8a,11,12,13,14b-tetradecahydropicene-4a-carboxamide |
|---|---|
| PubChem CID | 127037419 |
| Molecular Formula | C32H51NO3 |
| Molecular Weight | 497.76 g/mol |
| Exact Mass | 497.39 |
| IUPAC Name | (1S,2R,4aS,6aR,6aS,6bR,8aR,12aR,14bS)-N-methoxy-N,1,2,6a,6b,9,9,12a-octamethyl-10-oxo-1,2,3,4,5,6,6a,7,8,8a,11,12,13,14b-tetradecahydropicene-4a-carboxamide |
| SMILES | CON(C)C(=O)[C@]12CC[C@@H](C)[C@H](C)[C@H]1C1=CC[C@@H]3[C@@]4(C)CCC(=O)C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C32H51NO3/c1-20-12-17-32(27(35)33(8)36-9)19-18-30(6)22(26(32)21(20)2)10-11-24-29(5)15-14-25(34)28(3,4)23(29)13-16-31(24,30)7/h10,20-21,23-24,26H,11-19H2,1-9H3/t20-,21+,23+,24-,26+,29+,30-,31-,32+/m1/s1 |
| InChIKey | OBVXQIMQOOJEEC-ISXFKSRVSA-N |
| XLogP | 7.23 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.76 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|