C31H49NO3 — CID 127037420
(1S,2R,4aS,6aR,6aS,6bR,8aR,12aR,14bS)-N-hydroxy-N,1,2,6a,6b,9,9,12a-octamethyl-10-oxo-1,2,3,4,5,6,6a,7,8,8a,11,12,13,14b-tetradecahydropicene-4a-carboxamide (PubChem CID 127037420) has the molecular formula C31H49NO3 and a molecular weight of 483.74 g/mol. Its IUPAC name is (1S,2R,4aS,6aR,6aS,6bR,8aR,12aR,14bS)-N-hydroxy-N,1,2,6a,6b,9,9,12a-octamethyl-10-oxo-1,2,3,4,5,6,6a,7,8,8a,11,12,13,14b-tetradecahydropicene-4a-carboxamide.
| Compound Name | (1S,2R,4aS,6aR,6aS,6bR,8aR,12aR,14bS)-N-hydroxy-N,1,2,6a,6b,9,9,12a-octamethyl-10-oxo-1,2,3,4,5,6,6a,7,8,8a,11,12,13,14b-tetradecahydropicene-4a-carboxamide |
|---|---|
| PubChem CID | 127037420 |
| Molecular Formula | C31H49NO3 |
| Molecular Weight | 483.74 g/mol |
| Exact Mass | 483.37 |
| IUPAC Name | (1S,2R,4aS,6aR,6aS,6bR,8aR,12aR,14bS)-N-hydroxy-N,1,2,6a,6b,9,9,12a-octamethyl-10-oxo-1,2,3,4,5,6,6a,7,8,8a,11,12,13,14b-tetradecahydropicene-4a-carboxamide |
| SMILES | C[C@H]1[C@H](C)CC[C@]2(C(=O)N(C)O)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CCC(=O)C(C)(C)[C@@H]5CC[C@]43C)[C@H]12 |
| InChI | InChI=1S/C31H49NO3/c1-19-11-16-31(26(34)32(8)35)18-17-29(6)21(25(31)20(19)2)9-10-23-28(5)14-13-24(33)27(3,4)22(28)12-15-30(23,29)7/h9,19-20,22-23,25,35H,10-18H2,1-8H3/t19-,20+,22+,23-,25+,28+,29-,30-,31+/m1/s1 |
| InChIKey | DAZBAKCEJSTLNE-ZOPQKVJUSA-N |
| XLogP | 7.06 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.74 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|