About (2S,3S)-N-benzhydryl-2,3-dimethoxypent-4-en-1-amine
(2S,3S)-N-benzhydryl-2,3-dimethoxypent-4-en-1-amine (PubChem CID 127037429) has the molecular formula C20H25NO2
and a molecular weight of 311.43 g/mol. Its IUPAC name is (2S,3S)-N-benzhydryl-2,3-dimethoxypent-4-en-1-amine.
Molecular Properties
| Compound Name | (2S,3S)-N-benzhydryl-2,3-dimethoxypent-4-en-1-amine |
| PubChem CID | 127037429 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | (2S,3S)-N-benzhydryl-2,3-dimethoxypent-4-en-1-amine |
| SMILES | C=C[C@H](OC)[C@H](CNC(c1ccccc1)c1ccccc1)OC |
| InChI | InChI=1S/C20H25NO2/c1-4-18(22-2)19(23-3)15-21-20(16-11-7-5-8-12-16)17-13-9-6-10-14-17/h4-14,18-21H,1,15H2,2-3H3/t18-,19-/m0/s1 |
| InChIKey | QCYUAHIDVVUHFA-OALUTQOASA-N |
| XLogP | 3.58 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S,3S)-N-benzhydryl-2,3-dimethoxypent-4-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-N-benzhydryl-2,3-dimethoxypent-4-en-1-amine?
The IUPAC name of (2S,3S)-N-benzhydryl-2,3-dimethoxypent-4-en-1-amine (CID 127037429) is (2S,3S)-N-benzhydryl-2,3-dimethoxypent-4-en-1-amine.
What is the SMILES notation for (2S,3S)-N-benzhydryl-2,3-dimethoxypent-4-en-1-amine?
The canonical SMILES for (2S,3S)-N-benzhydryl-2,3-dimethoxypent-4-en-1-amine is C=C[C@H](OC)[C@H](CNC(c1ccccc1)c1ccccc1)OC.
What is the InChIKey of (2S,3S)-N-benzhydryl-2,3-dimethoxypent-4-en-1-amine?
The InChIKey is QCYUAHIDVVUHFA-OALUTQOASA-N. The full InChI is InChI=1S/C20H25NO2/c1-4-18(22-2)19(23-3)15-21-20(16-11-7-5-8-12-16)17-13-9-6-10-14-17/h4-14,18-21H,1,15H2,2-3H3/t18-,19-/m0/s1.
What are the key properties of (2S,3S)-N-benzhydryl-2,3-dimethoxypent-4-en-1-amine?
(2S,3S)-N-benzhydryl-2,3-dimethoxypent-4-en-1-amine has a molecular weight of 311.43 g/mol, XLogP of 3.58, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-N-benzhydryl-2,3-dimethoxypent-4-en-1-amine is sourced from PubChem (CID 127037429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).