C21H24N6O4 — CID 127037453
(3S)-3-(4-hydroxyphenyl)-3-[[2-[4-[3-(pyridin-2-ylamino)propyl]triazol-1-yl]acetyl]amino]propanoic acid (PubChem CID 127037453) has the molecular formula C21H24N6O4 and a molecular weight of 424.46 g/mol. Its IUPAC name is (3S)-3-(4-hydroxyphenyl)-3-[[2-[4-[3-(pyridin-2-ylamino)propyl]triazol-1-yl]acetyl]amino]propanoic acid.
| Compound Name | (3S)-3-(4-hydroxyphenyl)-3-[[2-[4-[3-(pyridin-2-ylamino)propyl]triazol-1-yl]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 127037453 |
| Molecular Formula | C21H24N6O4 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | (3S)-3-(4-hydroxyphenyl)-3-[[2-[4-[3-(pyridin-2-ylamino)propyl]triazol-1-yl]acetyl]amino]propanoic acid |
| SMILES | O=C(O)C[C@H](NC(=O)Cn1cc(CCCNc2ccccn2)nn1)c1ccc(O)cc1 |
| InChI | InChI=1S/C21H24N6O4/c28-17-8-6-15(7-9-17)18(12-21(30)31)24-20(29)14-27-13-16(25-26-27)4-3-11-23-19-5-1-2-10-22-19/h1-2,5-10,13,18,28H,3-4,11-12,14H2,(H,22,23)(H,24,29)(H,30,31)/t18-/m0/s1 |
| InChIKey | RZPZHTBHOXCBER-SFHVURJKSA-N |
| XLogP | 1.76 |
| TPSA | 142.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|