C31H49NO3 — CID 127037520
(4aS,6aR,6aS,6bR,8aR,12aR,14bS)-N-hydroxy-N,2,2,6a,6b,9,9,12a-octamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carboxamide (PubChem CID 127037520) has the molecular formula C31H49NO3 and a molecular weight of 483.74 g/mol. Its IUPAC name is (4aS,6aR,6aS,6bR,8aR,12aR,14bS)-N-hydroxy-N,2,2,6a,6b,9,9,12a-octamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carboxamide.
| Compound Name | (4aS,6aR,6aS,6bR,8aR,12aR,14bS)-N-hydroxy-N,2,2,6a,6b,9,9,12a-octamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carboxamide |
|---|---|
| PubChem CID | 127037520 |
| Molecular Formula | C31H49NO3 |
| Molecular Weight | 483.74 g/mol |
| Exact Mass | 483.37 |
| IUPAC Name | (4aS,6aR,6aS,6bR,8aR,12aR,14bS)-N-hydroxy-N,2,2,6a,6b,9,9,12a-octamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carboxamide |
| SMILES | CN(O)C(=O)[C@]12CCC(C)(C)C[C@H]1C1=CC[C@@H]3[C@@]4(C)CCC(=O)C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C31H49NO3/c1-26(2)15-17-31(25(34)32(8)35)18-16-29(6)20(21(31)19-26)9-10-23-28(5)13-12-24(33)27(3,4)22(28)11-14-30(23,29)7/h9,21-23,35H,10-19H2,1-8H3/t21-,22-,23+,28-,29+,30+,31-/m0/s1 |
| InChIKey | LMUOAZYLFICLON-VNNAKPRGSA-N |
| XLogP | 7.20 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.74 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|