C22H25NO6S — CID 127037653
diethyl 1,1-dioxo-3,5-diphenyl-1,4-thiazinane-2,6-dicarboxylate (PubChem CID 127037653) has the molecular formula C22H25NO6S and a molecular weight of 431.51 g/mol. Its IUPAC name is diethyl 1,1-dioxo-3,5-diphenyl-1,4-thiazinane-2,6-dicarboxylate.
| Compound Name | diethyl 1,1-dioxo-3,5-diphenyl-1,4-thiazinane-2,6-dicarboxylate |
|---|---|
| PubChem CID | 127037653 |
| Molecular Formula | C22H25NO6S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | diethyl 1,1-dioxo-3,5-diphenyl-1,4-thiazinane-2,6-dicarboxylate |
| SMILES | CCOC(=O)C1C(c2ccccc2)NC(c2ccccc2)C(C(=O)OCC)S1(=O)=O |
| InChI | InChI=1S/C22H25NO6S/c1-3-28-21(24)19-17(15-11-7-5-8-12-15)23-18(16-13-9-6-10-14-16)20(30(19,26)27)22(25)29-4-2/h5-14,17-20,23H,3-4H2,1-2H3 |
| InChIKey | NMGNOOFYGRPFQH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |