C27H34O5 — CID 127037734
(2S,5'aR,7'aR,11'aR,11'bR)-5',5',6,7,7'a,9',11'b-heptamethylspiro[3H-furo[3,2-c]pyran-2,8'-6,7,11,11a-tetrahydro-5aH-benzo[g][2]benzoxepine]-3',4-dione (PubChem CID 127037734) has the molecular formula C27H34O5 and a molecular weight of 438.56 g/mol. Its IUPAC name is (2S,5'aR,7'aR,11'aR,11'bR)-5',5',6,7,7'a,9',11'b-heptamethylspiro[3H-furo[3,2-c]pyran-2,8'-6,7,11,11a-tetrahydro-5aH-benzo[g][2]benzoxepine]-3',4-dione.
| Compound Name | (2S,5'aR,7'aR,11'aR,11'bR)-5',5',6,7,7'a,9',11'b-heptamethylspiro[3H-furo[3,2-c]pyran-2,8'-6,7,11,11a-tetrahydro-5aH-benzo[g][2]benzoxepine]-3',4-dione |
|---|---|
| PubChem CID | 127037734 |
| Molecular Formula | C27H34O5 |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | (2S,5'aR,7'aR,11'aR,11'bR)-5',5',6,7,7'a,9',11'b-heptamethylspiro[3H-furo[3,2-c]pyran-2,8'-6,7,11,11a-tetrahydro-5aH-benzo[g][2]benzoxepine]-3',4-dione |
| SMILES | CC1=CC[C@@H]2[C@@]3(C)C=CC(=O)OC(C)(C)[C@@H]3CC[C@@]2(C)[C@]12Cc1c(c(C)c(C)oc1=O)O2 |
| InChI | InChI=1S/C27H34O5/c1-15-8-9-20-25(6)12-11-21(28)31-24(4,5)19(25)10-13-26(20,7)27(15)14-18-22(32-27)16(2)17(3)30-23(18)29/h8,11-12,19-20H,9-10,13-14H2,1-7H3/t19-,20+,25-,26+,27-/m0/s1 |
| InChIKey | FJGNDLFUTLJNOP-YJHFSHLRSA-N |
| XLogP | 5.21 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|