About (1S,5R)-1-(hydroxymethyl)-4-phenylspiro[4.5]deca-3,9-dien-8-one
(1S,5R)-1-(hydroxymethyl)-4-phenylspiro[4.5]deca-3,9-dien-8-one (PubChem CID 127037847) has the molecular formula C17H18O2
and a molecular weight of 254.33 g/mol. Its IUPAC name is (1S,5R)-1-(hydroxymethyl)-4-phenylspiro[4.5]deca-3,9-dien-8-one.
Molecular Properties
| Compound Name | (1S,5R)-1-(hydroxymethyl)-4-phenylspiro[4.5]deca-3,9-dien-8-one |
| PubChem CID | 127037847 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | (1S,5R)-1-(hydroxymethyl)-4-phenylspiro[4.5]deca-3,9-dien-8-one |
| SMILES | O=C1C=C[C@@]2(CC1)C(c1ccccc1)=CC[C@@H]2CO |
| InChI | InChI=1S/C17H18O2/c18-12-14-6-7-16(13-4-2-1-3-5-13)17(14)10-8-15(19)9-11-17/h1-5,7-8,10,14,18H,6,9,11-12H2/t14-,17+/m1/s1 |
| InChIKey | SHXWGXXNTZXPBX-PBHICJAKSA-N |
| XLogP | 2.99 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S,5R)-1-(hydroxymethyl)-4-phenylspiro[4.5]deca-3,9-dien-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,5R)-1-(hydroxymethyl)-4-phenylspiro[4.5]deca-3,9-dien-8-one?
The IUPAC name of (1S,5R)-1-(hydroxymethyl)-4-phenylspiro[4.5]deca-3,9-dien-8-one (CID 127037847) is (1S,5R)-1-(hydroxymethyl)-4-phenylspiro[4.5]deca-3,9-dien-8-one.
What is the SMILES notation for (1S,5R)-1-(hydroxymethyl)-4-phenylspiro[4.5]deca-3,9-dien-8-one?
The canonical SMILES for (1S,5R)-1-(hydroxymethyl)-4-phenylspiro[4.5]deca-3,9-dien-8-one is O=C1C=C[C@@]2(CC1)C(c1ccccc1)=CC[C@@H]2CO.
What is the InChIKey of (1S,5R)-1-(hydroxymethyl)-4-phenylspiro[4.5]deca-3,9-dien-8-one?
The InChIKey is SHXWGXXNTZXPBX-PBHICJAKSA-N. The full InChI is InChI=1S/C17H18O2/c18-12-14-6-7-16(13-4-2-1-3-5-13)17(14)10-8-15(19)9-11-17/h1-5,7-8,10,14,18H,6,9,11-12H2/t14-,17+/m1/s1.
What are the key properties of (1S,5R)-1-(hydroxymethyl)-4-phenylspiro[4.5]deca-3,9-dien-8-one?
(1S,5R)-1-(hydroxymethyl)-4-phenylspiro[4.5]deca-3,9-dien-8-one has a molecular weight of 254.33 g/mol, XLogP of 2.99, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,5R)-1-(hydroxymethyl)-4-phenylspiro[4.5]deca-3,9-dien-8-one is sourced from PubChem (CID 127037847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).