C14H14Br2N2O3 — CID 127037854
6,8-dibromo-N-[2-(dimethylamino)ethyl]-2-oxochromene-3-carboxamide (PubChem CID 127037854) has the molecular formula C14H14Br2N2O3 and a molecular weight of 418.09 g/mol. Its IUPAC name is 6,8-dibromo-N-[2-(dimethylamino)ethyl]-2-oxochromene-3-carboxamide.
| Compound Name | 6,8-dibromo-N-[2-(dimethylamino)ethyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 127037854 |
| Molecular Formula | C14H14Br2N2O3 |
| Molecular Weight | 418.09 g/mol |
| Exact Mass | 415.94 |
| IUPAC Name | 6,8-dibromo-N-[2-(dimethylamino)ethyl]-2-oxochromene-3-carboxamide |
| SMILES | CN(C)CCNC(=O)c1cc2cc(Br)cc(Br)c2oc1=O |
| InChI | InChI=1S/C14H14Br2N2O3/c1-18(2)4-3-17-13(19)10-6-8-5-9(15)7-11(16)12(8)21-14(10)20/h5-7H,3-4H2,1-2H3,(H,17,19) |
| InChIKey | PWPSUNKGGFFISO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.09 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|