C29H31N11O3 — CID 127037929
1-[2-[2-(dimethylamino)ethylamino]-4-pyridin-2-yl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]-2-[4-methoxy-7-(3-methyl-1,2,4-triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione (PubChem CID 127037929) has the molecular formula C29H31N11O3 and a molecular weight of 581.64 g/mol. Its IUPAC name is 1-[2-[2-(dimethylamino)ethylamino]-4-pyridin-2-yl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]-2-[4-methoxy-7-(3-methyl-1,2,4-triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione.
| Compound Name | 1-[2-[2-(dimethylamino)ethylamino]-4-pyridin-2-yl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]-2-[4-methoxy-7-(3-methyl-1,2,4-triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 127037929 |
| Molecular Formula | C29H31N11O3 |
| Molecular Weight | 581.64 g/mol |
| Exact Mass | 581.26 |
| IUPAC Name | 1-[2-[2-(dimethylamino)ethylamino]-4-pyridin-2-yl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]-2-[4-methoxy-7-(3-methyl-1,2,4-triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione |
| SMILES | COc1cnc(-n2cnc(C)n2)c2[nH]cc(C(=O)C(=O)N3CCc4c(nc(NCCN(C)C)nc4-c4ccccn4)C3)c12 |
| InChI | InChI=1S/C29H31N11O3/c1-17-34-16-40(37-17)27-25-23(22(43-4)14-33-27)19(13-32-25)26(41)28(42)39-11-8-18-21(15-39)35-29(31-10-12-38(2)3)36-24(18)20-7-5-6-9-30-20/h5-7,9,13-14,16,32H,8,10-12,15H2,1-4H3,(H,31,35,36) |
| InChIKey | WVIDPSWMNHJGEE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 159.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.64 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|