C27H32Br2N2O4S — CID 127037960
(1R,4aS,9E,10aR)-6-bromo-9-[2-[(5-bromothiophene-2-carbonyl)amino]ethoxyimino]-1,4a-dimethyl-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylic acid (PubChem CID 127037960) has the molecular formula C27H32Br2N2O4S and a molecular weight of 640.44 g/mol. Its IUPAC name is (1R,4aS,9E,10aR)-6-bromo-9-[2-[(5-bromothiophene-2-carbonyl)amino]ethoxyimino]-1,4a-dimethyl-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylic acid.
| Compound Name | (1R,4aS,9E,10aR)-6-bromo-9-[2-[(5-bromothiophene-2-carbonyl)amino]ethoxyimino]-1,4a-dimethyl-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylic acid |
|---|---|
| PubChem CID | 127037960 |
| Molecular Formula | C27H32Br2N2O4S |
| Molecular Weight | 640.44 g/mol |
| Exact Mass | 638.04 |
| IUPAC Name | (1R,4aS,9E,10aR)-6-bromo-9-[2-[(5-bromothiophene-2-carbonyl)amino]ethoxyimino]-1,4a-dimethyl-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylic acid |
| SMILES | CC(C)c1cc2c(cc1Br)[C@@]1(C)CCC[C@@](C)(C(=O)O)[C@@H]1C/C2=N\OCCNC(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C27H32Br2N2O4S/c1-15(2)16-12-17-18(13-19(16)28)26(3)8-5-9-27(4,25(33)34)22(26)14-20(17)31-35-11-10-30-24(32)21-6-7-23(29)36-21/h6-7,12-13,15,22H,5,8-11,14H2,1-4H3,(H,30,32)(H,33,34)/b31-20+/t22-,26-,27-/m1/s1 |
| InChIKey | BHMSQXGSSRAHME-KDEBXRSSSA-N |
| XLogP | 7.10 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.44 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|